C17H21F3O4S — CID 134916301
[[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate (PubChem CID 134916301) has the molecular formula C17H21F3O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is [[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate.
| Compound Name | [[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134916301 |
| Molecular Formula | C17H21F3O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@H]1OC(C)(C)O[C@@H]1C(OC(=O)C(F)(F)F)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H21F3O4S/c1-5-12-13(24-16(3,4)23-12)14(22-15(21)17(18,19)20)25-11-8-6-10(2)7-9-11/h6-9,12-14H,5H2,1-4H3/t12-,13+,14?/m1/s1 |
| InChIKey | NYFKMJNGVNBXCI-AMIUJLCOSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|