C18H19F3O6S2 — CID 14795357
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate (PubChem CID 14795357) has the molecular formula C18H19F3O6S2 and a molecular weight of 452.47 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate |
|---|---|
| PubChem CID | 14795357 |
| Molecular Formula | C18H19F3O6S2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2ccccc2C(F)(F)F)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19F3O6S2/c1-9(22)25-13-8-28-17(16(27-11(3)24)15(13)26-10(2)23)29-14-7-5-4-6-12(14)18(19,20)21/h4-7,13,15-17H,8H2,1-3H3/t13-,15+,16-,17+/m1/s1 |
| InChIKey | BDDRORLPYFEXGP-XBVQOTNRSA-N |
| XLogP | 3.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|