C20H23F3O7S — CID 145129089
[(3R,6R)-3,5-diacetyloxy-4-methyl-6-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 145129089) has the molecular formula C20H23F3O7S and a molecular weight of 464.46 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-4-methyl-6-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145129089 |
| Molecular Formula | C20H23F3O7S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cccc(C(F)(F)F)c2)C(OC(C)=O)C(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H23F3O7S/c1-10-17(28-12(3)25)16(9-27-11(2)24)30-19(18(10)29-13(4)26)31-15-7-5-6-14(8-15)20(21,22)23/h5-8,10,16-19H,9H2,1-4H3/t10?,16?,17-,18?,19-/m1/s1 |
| InChIKey | MNCIKCPPIZAKIJ-OHVXTMIKSA-N |
| XLogP | 3.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|