C14H20O2S — CID 102351020
S-phenyl (2S,3R)-3-hydroxy-2,5-dimethylhexanethioate (PubChem CID 102351020) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-2,5-dimethylhexanethioate.
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-2,5-dimethylhexanethioate |
|---|---|
| PubChem CID | 102351020 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-2,5-dimethylhexanethioate |
| SMILES | CC(C)C[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H20O2S/c1-10(2)9-13(15)11(3)14(16)17-12-7-5-4-6-8-12/h4-8,10-11,13,15H,9H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | VQWLTDWXIGDDLT-WCQYABFASA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|