C18H30O3SSi — CID 10089515
S-phenyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate (PubChem CID 10089515) has the molecular formula C18H30O3SSi and a molecular weight of 354.59 g/mol. Its IUPAC name is S-phenyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate.
| Compound Name | S-phenyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
|---|---|
| PubChem CID | 10089515 |
| Molecular Formula | C18H30O3SSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | S-phenyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
| SMILES | CCC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C18H30O3SSi/c1-7-11-15(19)16(21-23(5,6)18(2,3)4)17(20)22-14-12-9-8-10-13-14/h8-10,12-13,15-16,19H,7,11H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | HGCXUMHJHJPRLH-HZPDHXFCSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|