C13H18O2S — CID 86239541
S-phenyl 3-hydroxy-4,4-dimethylpentanethioate (PubChem CID 86239541) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is S-phenyl 3-hydroxy-4,4-dimethylpentanethioate.
| Compound Name | S-phenyl 3-hydroxy-4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 86239541 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | S-phenyl 3-hydroxy-4,4-dimethylpentanethioate |
| SMILES | CC(C)(C)C(O)CC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2,3)11(14)9-12(15)16-10-7-5-4-6-8-10/h4-8,11,14H,9H2,1-3H3 |
| InChIKey | ISROKMAPDPTAPQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|