C15H22O2S — CID 13262358
S-phenyl (2R,3S)-3-hydroxy-2-methyloctanethioate (PubChem CID 13262358) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is S-phenyl (2R,3S)-3-hydroxy-2-methyloctanethioate.
| Compound Name | S-phenyl (2R,3S)-3-hydroxy-2-methyloctanethioate |
|---|---|
| PubChem CID | 13262358 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | S-phenyl (2R,3S)-3-hydroxy-2-methyloctanethioate |
| SMILES | CCCCC[C@H](O)[C@@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C15H22O2S/c1-3-4-6-11-14(16)12(2)15(17)18-13-9-7-5-8-10-13/h5,7-10,12,14,16H,3-4,6,11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | PEISAKPWSPYKIO-OCCSQVGLSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|