C22H36O2SSi — CID 10249961
(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-8-phenylsulfanyloct-6-enal (PubChem CID 10249961) has the molecular formula C22H36O2SSi and a molecular weight of 392.68 g/mol. Its IUPAC name is (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-8-phenylsulfanyloct-6-enal.
| Compound Name | (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-8-phenylsulfanyloct-6-enal |
|---|---|
| PubChem CID | 10249961 |
| Molecular Formula | C22H36O2SSi |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-8-phenylsulfanyloct-6-enal |
| SMILES | CC(C)(C=O)[C@H](CC/C=C/CSc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O2SSi/c1-21(2,3)26(6,7)24-20(22(4,5)18-23)16-12-9-13-17-25-19-14-10-8-11-15-19/h8-11,13-15,18,20H,12,16-17H2,1-7H3/b13-9+/t20-/m0/s1 |
| InChIKey | NBKJRLKHJMHKIV-SQSZOCELSA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|