C18H28O2SSi — CID 10735635
3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanal (PubChem CID 10735635) has the molecular formula C18H28O2SSi and a molecular weight of 336.57 g/mol. Its IUPAC name is 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanal.
| Compound Name | 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanal |
|---|---|
| PubChem CID | 10735635 |
| Molecular Formula | C18H28O2SSi |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanal |
| SMILES | C[Si](C)(C)OC(CC=O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H28O2SSi/c1-22(2,3)20-17(12-15-19)18(13-8-5-9-14-18)21-16-10-6-4-7-11-16/h4,6-7,10-11,15,17H,5,8-9,12-14H2,1-3H3 |
| InChIKey | XGOSVDRXYBJJQZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|