C19H30O2S — CID 134875146
4-methoxy-3-methyl-5-phenylsulfanylundecan-2-one (PubChem CID 134875146) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is 4-methoxy-3-methyl-5-phenylsulfanylundecan-2-one.
| Compound Name | 4-methoxy-3-methyl-5-phenylsulfanylundecan-2-one |
|---|---|
| PubChem CID | 134875146 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-methoxy-3-methyl-5-phenylsulfanylundecan-2-one |
| SMILES | CCCCCCC(Sc1ccccc1)C(OC)C(C)C(C)=O |
| InChI | InChI=1S/C19H30O2S/c1-5-6-7-11-14-18(19(21-4)15(2)16(3)20)22-17-12-9-8-10-13-17/h8-10,12-13,15,18-19H,5-7,11,14H2,1-4H3 |
| InChIKey | MMLTTZAQYLDBQM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|