C20H32O3SSi — CID 10619804
ethyl 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanoate (PubChem CID 10619804) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is ethyl 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanoate.
| Compound Name | ethyl 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 10619804 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethyl 3-(1-phenylsulfanylcyclohexyl)-3-trimethylsilyloxypropanoate |
| SMILES | CCOC(=O)CC(O[Si](C)(C)C)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H32O3SSi/c1-5-22-19(21)16-18(23-25(2,3)4)20(14-10-7-11-15-20)24-17-12-8-6-9-13-17/h6,8-9,12-13,18H,5,7,10-11,14-16H2,1-4H3 |
| InChIKey | QVDCOKOVRHEJFA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|