C17H23FO3S — CID 102444906
ethyl 3-cyclohexyl-2-fluoro-3-hydroxy-2-phenylsulfanylpropanoate (PubChem CID 102444906) has the molecular formula C17H23FO3S and a molecular weight of 326.43 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-2-fluoro-3-hydroxy-2-phenylsulfanylpropanoate.
| Compound Name | ethyl 3-cyclohexyl-2-fluoro-3-hydroxy-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 102444906 |
| Molecular Formula | C17H23FO3S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 3-cyclohexyl-2-fluoro-3-hydroxy-2-phenylsulfanylpropanoate |
| SMILES | CCOC(=O)C(F)(Sc1ccccc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C17H23FO3S/c1-2-21-16(20)17(18,22-14-11-7-4-8-12-14)15(19)13-9-5-3-6-10-13/h4,7-8,11-13,15,19H,2-3,5-6,9-10H2,1H3 |
| InChIKey | SSWQVZFCKQZKCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |