C21H34O3SSi — CID 134848255
(5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 134848255) has the molecular formula C21H34O3SSi and a molecular weight of 394.65 g/mol. Its IUPAC name is (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 134848255 |
| Molecular Formula | C21H34O3SSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | CC[C@H](CC1(Sc2ccccc2)C[C@H](C)OC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3SSi/c1-8-17(24-26(6,7)20(3,4)5)15-21(14-16(2)23-19(21)22)25-18-12-10-9-11-13-18/h9-13,16-17H,8,14-15H2,1-7H3/t16-,17+,21?/m0/s1 |
| InChIKey | FBONSFMRXGQEMU-NXRUOVBSSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|