C20H27IO2S — CID 15705127
(3R,5S)-3-[(E)-9-iodonon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 15705127) has the molecular formula C20H27IO2S and a molecular weight of 458.41 g/mol. Its IUPAC name is (3R,5S)-3-[(E)-9-iodonon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3R,5S)-3-[(E)-9-iodonon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 15705127 |
| Molecular Formula | C20H27IO2S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (3R,5S)-3-[(E)-9-iodonon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1C[C@@](CCCCCCC/C=C/I)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H27IO2S/c1-17-16-20(19(22)23-17,24-18-12-8-7-9-13-18)14-10-5-3-2-4-6-11-15-21/h7-9,11-13,15,17H,2-6,10,14,16H2,1H3/b15-11+/t17-,20+/m0/s1 |
| InChIKey | KSLAXFOKWNWUJM-PNMKSGFKSA-N |
| XLogP | 6.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|