C26H39IO3SSi — CID 11966383
(3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-iodonon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 11966383) has the molecular formula C26H39IO3SSi and a molecular weight of 586.65 g/mol. Its IUPAC name is (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-iodonon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-iodonon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11966383 |
| Molecular Formula | C26H39IO3SSi |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-iodonon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@@H]1C[C@](C[C@H](CCCCCC#CI)O[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C26H39IO3SSi/c1-21-19-26(24(28)29-21,31-23-16-12-10-13-17-23)20-22(15-11-8-7-9-14-18-27)30-32(5,6)25(2,3)4/h10,12-13,16-17,21-22H,7-9,11,15,19-20H2,1-6H3/t21-,22+,26-/m1/s1 |
| InChIKey | NGJRTVMFPPXGEC-TVZXLZGTSA-N |
| XLogP | 7.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|