C22H36O3SSi — CID 10949598
(5R)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylhexyl]oxolan-2-one (PubChem CID 10949598) has the molecular formula C22H36O3SSi and a molecular weight of 408.68 g/mol. Its IUPAC name is (5R)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylhexyl]oxolan-2-one.
| Compound Name | (5R)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylhexyl]oxolan-2-one |
|---|---|
| PubChem CID | 10949598 |
| Molecular Formula | C22H36O3SSi |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (5R)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylhexyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCCSc1ccccc1)CC[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C22H36O3SSi/c1-22(2,3)27(4,5)25-19(14-13-18-15-16-21(23)24-18)10-9-17-26-20-11-7-6-8-12-20/h6-8,11-12,18-19H,9-10,13-17H2,1-5H3/t18-,19+/m1/s1 |
| InChIKey | DONWNSGPIRQINK-MOPGFXCFSA-N |
| XLogP | 6.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|