C20H30O3SSi — CID 10809690
(3S,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-one (PubChem CID 10809690) has the molecular formula C20H30O3SSi and a molecular weight of 378.61 g/mol. Its IUPAC name is (3S,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (3S,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 10809690 |
| Molecular Formula | C20H30O3SSi |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (3S,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@]12C[C@H](Sc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C20H30O3SSi/c1-19(2,3)25(4,5)23-17-12-9-13-20(17)14-16(18(21)22-20)24-15-10-7-6-8-11-15/h6-8,10-11,16-17H,9,12-14H2,1-5H3/t16-,17+,20-/m0/s1 |
| InChIKey | JYIYMGYGYIYDPT-QKLQHJQFSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|