C24H40O4SSi — CID 138975873
S-phenyl (4S)-4-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-4-hydroxypentanethioate (PubChem CID 138975873) has the molecular formula C24H40O4SSi and a molecular weight of 452.73 g/mol. Its IUPAC name is S-phenyl (4S)-4-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-4-hydroxypentanethioate.
| Compound Name | S-phenyl (4S)-4-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-4-hydroxypentanethioate |
|---|---|
| PubChem CID | 138975873 |
| Molecular Formula | C24H40O4SSi |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | S-phenyl (4S)-4-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-4-hydroxypentanethioate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)CC[C@H]([C@@](C)(O)CCC(=O)Sc2ccccc2)O1 |
| InChI | InChI=1S/C24H40O4SSi/c1-18(28-30(7,8)22(2,3)4)24(6)17-14-20(27-24)23(5,26)16-15-21(25)29-19-12-10-9-11-13-19/h9-13,18,20,26H,14-17H2,1-8H3/t18-,20-,23+,24+/m1/s1 |
| InChIKey | COKDTMOAEJPIPW-YKBLPDKLSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|