C27H48O4SSi2 — CID 10940330
(5S)-3-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10940330) has the molecular formula C27H48O4SSi2 and a molecular weight of 524.92 g/mol. Its IUPAC name is (5S)-3-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10940330 |
| Molecular Formula | C27H48O4SSi2 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (5S)-3-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(CC[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C27H48O4SSi2/c1-21-19-27(24(28)30-21,32-23-15-13-12-14-16-23)18-17-22(31-34(10,11)26(5,6)7)20-29-33(8,9)25(2,3)4/h12-16,21-22H,17-20H2,1-11H3/t21-,22+,27?/m0/s1 |
| InChIKey | NVBIBEYLWXMQKL-QNWUEUMSSA-N |
| XLogP | 8.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|