C27H44O3SSi — CID 10624439
(5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxydec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10624439) has the molecular formula C27H44O3SSi and a molecular weight of 476.80 g/mol. Its IUPAC name is (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxydec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxydec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10624439 |
| Molecular Formula | C27H44O3SSi |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxydec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C=CCCCCCC[C@H](CC1(Sc2ccccc2)C[C@H](C)OC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O3SSi/c1-8-9-10-11-12-14-17-23(30-32(6,7)26(3,4)5)21-27(20-22(2)29-25(27)28)31-24-18-15-13-16-19-24/h8,13,15-16,18-19,22-23H,1,9-12,14,17,20-21H2,2-7H3/t22-,23+,27?/m0/s1 |
| InChIKey | NKBJQFMOWJHZNC-FOCHENRBSA-N |
| XLogP | 8.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|