C20H24O4S — CID 132534599
(3S,5S)-5-methyl-3-[[(2R,5R)-5-(2-oxobut-3-enyl)oxolan-2-yl]methyl]-3-phenylsulfanyloxolan-2-one (PubChem CID 132534599) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is (3S,5S)-5-methyl-3-[[(2R,5R)-5-(2-oxobut-3-enyl)oxolan-2-yl]methyl]-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,5S)-5-methyl-3-[[(2R,5R)-5-(2-oxobut-3-enyl)oxolan-2-yl]methyl]-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 132534599 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3S,5S)-5-methyl-3-[[(2R,5R)-5-(2-oxobut-3-enyl)oxolan-2-yl]methyl]-3-phenylsulfanyloxolan-2-one |
| SMILES | C=CC(=O)C[C@H]1CC[C@H](C[C@@]2(Sc3ccccc3)C[C@H](C)OC2=O)O1 |
| InChI | InChI=1S/C20H24O4S/c1-3-15(21)11-16-9-10-17(24-16)13-20(12-14(2)23-19(20)22)25-18-7-5-4-6-8-18/h3-8,14,16-17H,1,9-13H2,2H3/t14-,16+,17+,20-/m0/s1 |
| InChIKey | YGWGJXRKWZKWJF-MCNSXXNHSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|