C20H28O4S — CID 10384184
methyl 2-[(2R,3R,4S)-2-hexyl-3-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10384184) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-2-hexyl-3-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-2-hexyl-3-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10384184 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-2-hexyl-3-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | CCCCCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@]1(C)CC(=O)OC |
| InChI | InChI=1S/C20H28O4S/c1-4-5-6-10-13-16-20(2,14-17(21)23-3)18(19(22)24-16)25-15-11-8-7-9-12-15/h7-9,11-12,16,18H,4-6,10,13-14H2,1-3H3/t16-,18-,20-/m1/s1 |
| InChIKey | GRZWOFZCQWGGQX-YVWKXTFCSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|