C21H34O3SSi — CID 10894532
(5S)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10894532) has the molecular formula C21H34O3SSi and a molecular weight of 394.65 g/mol. Its IUPAC name is (5S)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10894532 |
| Molecular Formula | C21H34O3SSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (5S)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(CCCCO[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C21H34O3SSi/c1-17-16-21(19(22)24-17,25-18-12-8-7-9-13-18)14-10-11-15-23-26(5,6)20(2,3)4/h7-9,12-13,17H,10-11,14-16H2,1-6H3/t17-,21?/m0/s1 |
| InChIKey | HXQSMJCZZSOGBN-PBVYKCSPSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|