C17H26O2Si — CID 10880810
(3S,4R,5S)-3-butyl-4-[dimethyl(phenyl)silyl]-5-methyloxolan-2-one (PubChem CID 10880810) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (3S,4R,5S)-3-butyl-4-[dimethyl(phenyl)silyl]-5-methyloxolan-2-one.
| Compound Name | (3S,4R,5S)-3-butyl-4-[dimethyl(phenyl)silyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 10880810 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3S,4R,5S)-3-butyl-4-[dimethyl(phenyl)silyl]-5-methyloxolan-2-one |
| SMILES | CCCC[C@H]1C(=O)O[C@@H](C)[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H26O2Si/c1-5-6-12-15-16(13(2)19-17(15)18)20(3,4)14-10-8-7-9-11-14/h7-11,13,15-16H,5-6,12H2,1-4H3/t13-,15+,16-/m0/s1 |
| InChIKey | KPGAKVLDQFRUNF-IMJJTQAJSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|