C23H36O3SSi — CID 10788288
(5S)-3-phenylsulfanyl-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one (PubChem CID 10788288) has the molecular formula C23H36O3SSi and a molecular weight of 420.69 g/mol. Its IUPAC name is (5S)-3-phenylsulfanyl-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one.
| Compound Name | (5S)-3-phenylsulfanyl-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10788288 |
| Molecular Formula | C23H36O3SSi |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (5S)-3-phenylsulfanyl-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
| SMILES | C=CCC1(Sc2ccccc2)C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC1=O |
| InChI | InChI=1S/C23H36O3SSi/c1-8-14-23(27-21-12-10-9-11-13-21)15-20(26-22(23)24)16-25-28(17(2)3,18(4)5)19(6)7/h8-13,17-20H,1,14-16H2,2-7H3/t20-,23?/m0/s1 |
| InChIKey | MGRWQLGPICAAPM-AJZOCDQUSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|