C17H26O3SSi — CID 10246539
(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylsulfanylmethyl)oxolan-2-one (PubChem CID 10246539) has the molecular formula C17H26O3SSi and a molecular weight of 338.55 g/mol. Its IUPAC name is (4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylsulfanylmethyl)oxolan-2-one.
| Compound Name | (4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylsulfanylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10246539 |
| Molecular Formula | C17H26O3SSi |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylsulfanylmethyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)O[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C17H26O3SSi/c1-17(2,3)22(4,5)20-14-11-16(18)19-15(14)12-21-13-9-7-6-8-10-13/h6-10,14-15H,11-12H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | DEOPRKMGSKZUGV-CABCVRRESA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|