C11H12O3S — CID 139091577
(3S,4S,5R)-4-hydroxy-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 139091577) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,4S,5R)-4-hydroxy-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 139091577 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C11H12O3S/c1-7-9(12)10(11(13)14-7)15-8-5-3-2-4-6-8/h2-7,9-10,12H,1H3/t7-,9+,10+/m1/s1 |
| InChIKey | JLQUNNZFCXUFMM-JEZHCXPESA-N |
| XLogP | 1.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |