C23H32FNO3SSi — CID 101265769
ethyl (3R,5Z,7E)-3-[tert-butyl(dimethyl)silyl]oxy-8-cyano-4-(4-fluorophenyl)sulfanylocta-5,7-dienoate (PubChem CID 101265769) has the molecular formula C23H32FNO3SSi and a molecular weight of 449.66 g/mol. Its IUPAC name is ethyl (3R,5Z,7E)-3-[tert-butyl(dimethyl)silyl]oxy-8-cyano-4-(4-fluorophenyl)sulfanylocta-5,7-dienoate.
| Compound Name | ethyl (3R,5Z,7E)-3-[tert-butyl(dimethyl)silyl]oxy-8-cyano-4-(4-fluorophenyl)sulfanylocta-5,7-dienoate |
|---|---|
| PubChem CID | 101265769 |
| Molecular Formula | C23H32FNO3SSi |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | ethyl (3R,5Z,7E)-3-[tert-butyl(dimethyl)silyl]oxy-8-cyano-4-(4-fluorophenyl)sulfanylocta-5,7-dienoate |
| SMILES | CCOC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C(/C=C\C=C\C#N)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C23H32FNO3SSi/c1-7-27-22(26)17-20(28-30(5,6)23(2,3)4)21(11-9-8-10-16-25)29-19-14-12-18(24)13-15-19/h8-15,20-21H,7,17H2,1-6H3/b10-8+,11-9-/t20-,21?/m1/s1 |
| InChIKey | ZRXGITQDTYYJCH-RRXIUGFFSA-N |
| XLogP | 6.27 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|