C12H15FO3S — CID 82775915
ethyl 4-(4-fluorophenyl)sulfanyl-3-hydroxybutanoate (PubChem CID 82775915) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)sulfanyl-3-hydroxybutanoate.
| Compound Name | ethyl 4-(4-fluorophenyl)sulfanyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82775915 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)sulfanyl-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FO3S/c1-2-16-12(15)7-10(14)8-17-11-5-3-9(13)4-6-11/h3-6,10,14H,2,7-8H2,1H3 |
| InChIKey | NJWSBHHIAYETDC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |