C12H17NO3S — CID 82776433
ethyl 4-(4-aminophenyl)sulfanyl-3-hydroxybutanoate (PubChem CID 82776433) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is ethyl 4-(4-aminophenyl)sulfanyl-3-hydroxybutanoate.
| Compound Name | ethyl 4-(4-aminophenyl)sulfanyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82776433 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | ethyl 4-(4-aminophenyl)sulfanyl-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CSc1ccc(N)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-2-16-12(15)7-10(14)8-17-11-5-3-9(13)4-6-11/h3-6,10,14H,2,7-8,13H2,1H3 |
| InChIKey | KDYIYRSSKLOQGQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|