C17H22N2O2 — CID 7084943
ethyl (3R)-3-(4-aminophenyl)-3-(2,5-dimethylpyrrol-1-yl)propanoate (PubChem CID 7084943) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is ethyl (3R)-3-(4-aminophenyl)-3-(2,5-dimethylpyrrol-1-yl)propanoate.
| Compound Name | ethyl (3R)-3-(4-aminophenyl)-3-(2,5-dimethylpyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 7084943 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethyl (3R)-3-(4-aminophenyl)-3-(2,5-dimethylpyrrol-1-yl)propanoate |
| SMILES | CCOC(=O)C[C@H](c1ccc(N)cc1)n1c(C)ccc1C |
| InChI | InChI=1S/C17H22N2O2/c1-4-21-17(20)11-16(14-7-9-15(18)10-8-14)19-12(2)5-6-13(19)3/h5-10,16H,4,11,18H2,1-3H3/t16-/m1/s1 |
| InChIKey | RGSGKYLEGHZUBS-MRXNPFEDSA-N |
| XLogP | 3.23 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|