C21H34FNO5S2 — CID 21401619
ethyl 7-[[5-(4-fluorophenyl)sulfanyl-4-hydroxypentyl]-methylsulfonylamino]heptanoate (PubChem CID 21401619) has the molecular formula C21H34FNO5S2 and a molecular weight of 463.64 g/mol. Its IUPAC name is ethyl 7-[[5-(4-fluorophenyl)sulfanyl-4-hydroxypentyl]-methylsulfonylamino]heptanoate.
| Compound Name | ethyl 7-[[5-(4-fluorophenyl)sulfanyl-4-hydroxypentyl]-methylsulfonylamino]heptanoate |
|---|---|
| PubChem CID | 21401619 |
| Molecular Formula | C21H34FNO5S2 |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | ethyl 7-[[5-(4-fluorophenyl)sulfanyl-4-hydroxypentyl]-methylsulfonylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(CCCC(O)CSc1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H34FNO5S2/c1-3-28-21(25)10-6-4-5-7-15-23(30(2,26)27)16-8-9-19(24)17-29-20-13-11-18(22)12-14-20/h11-14,19,24H,3-10,15-17H2,1-2H3 |
| InChIKey | HIWVTMPBBYBFLZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|