C23H37NO6S — CID 56834434
ethyl 7-[[(E,4S)-4-hydroxy-5-[3-(methoxymethyl)phenyl]pent-2-enyl]-methylsulfonylamino]heptanoate (PubChem CID 56834434) has the molecular formula C23H37NO6S and a molecular weight of 455.62 g/mol. Its IUPAC name is ethyl 7-[[(E,4S)-4-hydroxy-5-[3-(methoxymethyl)phenyl]pent-2-enyl]-methylsulfonylamino]heptanoate.
| Compound Name | ethyl 7-[[(E,4S)-4-hydroxy-5-[3-(methoxymethyl)phenyl]pent-2-enyl]-methylsulfonylamino]heptanoate |
|---|---|
| PubChem CID | 56834434 |
| Molecular Formula | C23H37NO6S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | ethyl 7-[[(E,4S)-4-hydroxy-5-[3-(methoxymethyl)phenyl]pent-2-enyl]-methylsulfonylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(C/C=C/[C@@H](O)Cc1cccc(COC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H37NO6S/c1-4-30-23(26)14-7-5-6-8-15-24(31(3,27)28)16-10-13-22(25)18-20-11-9-12-21(17-20)19-29-2/h9-13,17,22,25H,4-8,14-16,18-19H2,1-3H3/b13-10+/t22-/m1/s1 |
| InChIKey | QIUVCYLCXDNDSC-KCQSEKJDSA-N |
| XLogP | 3.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|