C28H32O5SSi — CID 10481389
(3S,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-one (PubChem CID 10481389) has the molecular formula C28H32O5SSi and a molecular weight of 508.71 g/mol. Its IUPAC name is (3S,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-one.
| Compound Name | (3S,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 10481389 |
| Molecular Formula | C28H32O5SSi |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (3S,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@](C)(S(=O)(=O)c2ccccc2)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O5SSi/c1-27(2,3)35(24-16-10-6-11-17-24,25-18-12-7-13-19-25)32-21-22-20-28(4,26(29)33-22)34(30,31)23-14-8-5-9-15-23/h5-19,22H,20-21H2,1-4H3/t22-,28-/m0/s1 |
| InChIKey | QZLVTQZUTCFTMG-DWACAAAGSA-N |
| XLogP | 4.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|