C29H34O4SSi — CID 11785457
ethyl 1-(benzenesulfonyl)-2-[[tert-butyl(diphenyl)silyl]methyl]cyclopropane-1-carboxylate (PubChem CID 11785457) has the molecular formula C29H34O4SSi and a molecular weight of 506.74 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-2-[[tert-butyl(diphenyl)silyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-2-[[tert-butyl(diphenyl)silyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11785457 |
| Molecular Formula | C29H34O4SSi |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-2-[[tert-butyl(diphenyl)silyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(S(=O)(=O)c2ccccc2)CC1C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H34O4SSi/c1-5-33-27(30)29(34(31,32)24-15-9-6-10-16-24)21-23(29)22-35(28(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23H,5,21-22H2,1-4H3 |
| InChIKey | HYQLDXDDUFFPLW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|