C33H34O3S2Si — CID 19937744
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-bis(phenylsulfanyl)oxolan-2-one (PubChem CID 19937744) has the molecular formula C33H34O3S2Si and a molecular weight of 570.85 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-bis(phenylsulfanyl)oxolan-2-one.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-bis(phenylsulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 19937744 |
| Molecular Formula | C33H34O3S2Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-bis(phenylsulfanyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](OCC1CC(Sc2ccccc2)(Sc2ccccc2)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34O3S2Si/c1-32(2,3)39(29-20-12-6-13-21-29,30-22-14-7-15-23-30)35-25-26-24-33(31(34)36-26,37-27-16-8-4-9-17-27)38-28-18-10-5-11-19-28/h4-23,26H,24-25H2,1-3H3 |
| InChIKey | TVGYJHRLVNVKEP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|