C27H30O5SSi — CID 10028719
(3R,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one (PubChem CID 10028719) has the molecular formula C27H30O5SSi and a molecular weight of 494.69 g/mol. Its IUPAC name is (3R,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one.
| Compound Name | (3R,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10028719 |
| Molecular Formula | C27H30O5SSi |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (3R,5S)-3-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](S(=O)(=O)c2ccccc2)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O5SSi/c1-27(2,3)34(23-15-9-5-10-16-23,24-17-11-6-12-18-24)31-20-21-19-25(26(28)32-21)33(29,30)22-13-7-4-8-14-22/h4-18,21,25H,19-20H2,1-3H3/t21-,25+/m0/s1 |
| InChIKey | WHWJYCVWSPLALM-SQJMNOBHSA-N |
| XLogP | 3.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|