C28H34O7SSi — CID 102241781
[(1R,2S,3R)-1-(benzenesulfonyl)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxybutyl] acetate (PubChem CID 102241781) has the molecular formula C28H34O7SSi and a molecular weight of 542.73 g/mol. Its IUPAC name is [(1R,2S,3R)-1-(benzenesulfonyl)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxybutyl] acetate.
| Compound Name | [(1R,2S,3R)-1-(benzenesulfonyl)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxybutyl] acetate |
|---|---|
| PubChem CID | 102241781 |
| Molecular Formula | C28H34O7SSi |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [(1R,2S,3R)-1-(benzenesulfonyl)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxybutyl] acetate |
| SMILES | CC(=O)O[C@@H]([C@@H](O)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H34O7SSi/c1-21(29)35-27(36(32,33)22-14-8-5-9-15-22)26(31)25(30)20-34-37(28(2,3)4,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,25-27,30-31H,20H2,1-4H3/t25-,26+,27-/m1/s1 |
| InChIKey | ZZZKWBFFMYVZPR-KWXIBIRDSA-N |
| XLogP | 2.65 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|