C26H30O4SSi — CID 15935855
[(1S)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane (PubChem CID 15935855) has the molecular formula C26H30O4SSi and a molecular weight of 466.68 g/mol. Its IUPAC name is [(1S)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(1S)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15935855 |
| Molecular Formula | C26H30O4SSi |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [(1S)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30O4SSi/c1-20(24-25(29-24)31(27,28)21-14-8-5-9-15-21)30-32(26(2,3)4,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24-25H,1-4H3/t20-,24+,25+/m0/s1 |
| InChIKey | NRQXWRFPYYMNLV-BUUDZMLXSA-N |
| XLogP | 4.15 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|