C27H32O3SSi — CID 10983467
tert-butyl-[(1S)-1-[(2S,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]ethoxy]-diphenylsilane (PubChem CID 10983467) has the molecular formula C27H32O3SSi and a molecular weight of 464.70 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2S,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10983467 |
| Molecular Formula | C27H32O3SSi |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]ethoxy]-diphenylsilane |
| SMILES | Cc1ccc([S@](=O)[C@H]2O[C@H]2[C@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H32O3SSi/c1-20-16-18-22(19-17-20)31(28)26-25(29-26)21(2)30-32(27(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,21,25-26H,1-5H3/t21-,25-,26+,31-/m0/s1 |
| InChIKey | QEVMNRSBDMFJDH-OREFXHGKSA-N |
| XLogP | 4.79 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|