C30H30O4SSi — CID 134936973
[1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-triphenylsilane (PubChem CID 134936973) has the molecular formula C30H30O4SSi and a molecular weight of 514.72 g/mol. Its IUPAC name is [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-triphenylsilane.
| Compound Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-triphenylsilane |
|---|---|
| PubChem CID | 134936973 |
| Molecular Formula | C30H30O4SSi |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-triphenylsilane |
| SMILES | CC(C)C(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30O4SSi/c1-23(2)28(29-30(33-29)35(31,32)24-15-7-3-8-16-24)34-36(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28-30H,1-2H3/t28?,29-,30-/m1/s1 |
| InChIKey | ACPVQYSLXZLDOJ-GVKMRLRKSA-N |
| XLogP | 3.89 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|