C27H32O4SSi — CID 10994473
tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyloxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 10994473) has the molecular formula C27H32O4SSi and a molecular weight of 480.70 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyloxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyloxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10994473 |
| Molecular Formula | C27H32O4SSi |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyloxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2O[C@@]2(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H32O4SSi/c1-21-16-18-22(19-17-21)32(28,29)25-27(5,31-25)20-30-33(26(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,25H,20H2,1-5H3/t25-,27+/m1/s1 |
| InChIKey | YENZCENVIHFGSI-VPUSJEBWSA-N |
| XLogP | 4.46 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|