C48H66O3SSi — CID 138983507
tert-butyl-[(2Z,6Z,10E,14E)-3,7,11,15,19-pentamethyl-9-(4-methylphenyl)sulfonylicosa-2,6,10,14,18-pentaenoxy]-diphenylsilane (PubChem CID 138983507) has the molecular formula C48H66O3SSi and a molecular weight of 751.21 g/mol. Its IUPAC name is tert-butyl-[(2Z,6Z,10E,14E)-3,7,11,15,19-pentamethyl-9-(4-methylphenyl)sulfonylicosa-2,6,10,14,18-pentaenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2Z,6Z,10E,14E)-3,7,11,15,19-pentamethyl-9-(4-methylphenyl)sulfonylicosa-2,6,10,14,18-pentaenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 138983507 |
| Molecular Formula | C48H66O3SSi |
| Molecular Weight | 751.21 g/mol |
| Exact Mass | 750.45 |
| IUPAC Name | tert-butyl-[(2Z,6Z,10E,14E)-3,7,11,15,19-pentamethyl-9-(4-methylphenyl)sulfonylicosa-2,6,10,14,18-pentaenoxy]-diphenylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(C/C(C)=C\CC/C(C)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C48H66O3SSi/c1-38(2)20-17-21-39(3)22-18-24-42(6)36-45(52(49,50)44-32-30-41(5)31-33-44)37-43(7)25-19-23-40(4)34-35-51-53(48(8,9)10,46-26-13-11-14-27-46)47-28-15-12-16-29-47/h11-16,20,22,25-34,36,45H,17-19,21,23-24,35,37H2,1-10H3/b39-22+,40-34-,42-36+,43-25- |
| InChIKey | GDCDAYJGMAYTNW-HXLXSEOBSA-N |
| XLogP | 12.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.21 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|