C30H36O4SSi — CID 11364407
[(E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylidenehex-4-enyl] 4-methylbenzenesulfonate (PubChem CID 11364407) has the molecular formula C30H36O4SSi and a molecular weight of 520.77 g/mol. Its IUPAC name is [(E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylidenehex-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylidenehex-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11364407 |
| Molecular Formula | C30H36O4SSi |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [(E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylidenehex-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C(/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H36O4SSi/c1-25(22-24-33-35(31,32)27-20-18-26(2)19-21-27)13-12-23-34-36(30(3,4)5,28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-21H,1,22-24H2,2-5H3/b13-12+ |
| InChIKey | QJAZJQRRFPUVMT-OUKQBFOZSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|