C22H31NO5S2Si — CID 10504946
N-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 10504946) has the molecular formula C22H31NO5S2Si and a molecular weight of 481.71 g/mol. Its IUPAC name is N-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10504946 |
| Molecular Formula | C22H31NO5S2Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)[C@H]2O[C@@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO5S2Si/c1-17-12-14-19(15-13-17)30(25,26)23-29(24,18-10-8-7-9-11-18)21-20(28-21)16-27-31(5,6)22(2,3)4/h7-15,20-21H,16H2,1-6H3/t20-,21-,29?/m1/s1 |
| InChIKey | CJIUENFPCCGIKY-LYJBJCQPSA-N |
| XLogP | 4.96 |
| TPSA | 85.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|