C22H29NO4S2 — CID 10836646
N-[[(2R,3R)-3-heptyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 10836646) has the molecular formula C22H29NO4S2 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[[(2R,3R)-3-heptyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3R)-3-heptyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10836646 |
| Molecular Formula | C22H29NO4S2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[[(2R,3R)-3-heptyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCCCCC[C@H]1O[C@@H]1S(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO4S2/c1-3-4-5-6-10-13-21-22(27-21)28(24,19-11-8-7-9-12-19)23-29(25,26)20-16-14-18(2)15-17-20/h7-9,11-12,14-17,21-22H,3-6,10,13H2,1-2H3/t21-,22-,28?/m1/s1 |
| InChIKey | NUAWSRUIIACSIX-FAVQVMMGSA-N |
| XLogP | 5.30 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|