C21H25NO4S2 — CID 10693400
N-[[(2R,3R)-3-cyclohexyloxiran-2-yl]-oxo-phenyl-lambda6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 10693400) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[[(2R,3R)-3-cyclohexyloxiran-2-yl]-oxo-phenyl-lambda6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3R)-3-cyclohexyloxiran-2-yl]-oxo-phenyl-lambda6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10693400 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[[(2R,3R)-3-cyclohexyloxiran-2-yl]-oxo-phenyl-lambda6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)[C@H]2O[C@@H]2C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25NO4S2/c1-16-12-14-19(15-13-16)28(24,25)22-27(23,18-10-6-3-7-11-18)21-20(26-21)17-8-4-2-5-9-17/h3,6-7,10-15,17,20-21H,2,4-5,8-9H2,1H3/t20-,21-,27?/m1/s1 |
| InChIKey | WMWOEZOGQZBGRX-NLDIKOHWSA-N |
| XLogP | 4.52 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|