C25H28O4S2 — CID 134886653
[(3R,4R)-4-(benzenesulfinyl)-1,6-diphenylhexan-3-yl] methanesulfonate (PubChem CID 134886653) has the molecular formula C25H28O4S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is [(3R,4R)-4-(benzenesulfinyl)-1,6-diphenylhexan-3-yl] methanesulfonate.
| Compound Name | [(3R,4R)-4-(benzenesulfinyl)-1,6-diphenylhexan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 134886653 |
| Molecular Formula | C25H28O4S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(3R,4R)-4-(benzenesulfinyl)-1,6-diphenylhexan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](CCc1ccccc1)[C@@H](CCc1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O4S2/c1-31(27,28)29-24(19-17-21-11-5-2-6-12-21)25(20-18-22-13-7-3-8-14-22)30(26)23-15-9-4-10-16-23/h2-16,24-25H,17-20H2,1H3/t24-,25-,30?/m1/s1 |
| InChIKey | RFXYVOUUJVKTAB-KUZPKSQGSA-N |
| XLogP | 4.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|