C22H28O4S2 — CID 134884602
[(E)-4-(benzenesulfinyl)-1-phenylnon-4-en-3-yl] methanesulfonate (PubChem CID 134884602) has the molecular formula C22H28O4S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is [(E)-4-(benzenesulfinyl)-1-phenylnon-4-en-3-yl] methanesulfonate.
| Compound Name | [(E)-4-(benzenesulfinyl)-1-phenylnon-4-en-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 134884602 |
| Molecular Formula | C22H28O4S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [(E)-4-(benzenesulfinyl)-1-phenylnon-4-en-3-yl] methanesulfonate |
| SMILES | CCCC/C=C(\C(CCc1ccccc1)OS(C)(=O)=O)S(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4S2/c1-3-4-7-16-22(27(23)20-14-10-6-11-15-20)21(26-28(2,24)25)18-17-19-12-8-5-9-13-19/h5-6,8-16,21H,3-4,7,17-18H2,1-2H3/b22-16+ |
| InChIKey | FXMDSZPBLJQEBX-CJLVFECKSA-N |
| XLogP | 4.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|