C34H47IO5SSi — CID 134882487
tert-butyl-[(3R)-3-[(3R)-1-iodo-5-methoxypentan-3-yl]oxy-5-(4-methylphenyl)sulfonylpentoxy]-diphenylsilane (PubChem CID 134882487) has the molecular formula C34H47IO5SSi and a molecular weight of 722.80 g/mol. Its IUPAC name is tert-butyl-[(3R)-3-[(3R)-1-iodo-5-methoxypentan-3-yl]oxy-5-(4-methylphenyl)sulfonylpentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3R)-3-[(3R)-1-iodo-5-methoxypentan-3-yl]oxy-5-(4-methylphenyl)sulfonylpentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134882487 |
| Molecular Formula | C34H47IO5SSi |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.20 |
| IUPAC Name | tert-butyl-[(3R)-3-[(3R)-1-iodo-5-methoxypentan-3-yl]oxy-5-(4-methylphenyl)sulfonylpentoxy]-diphenylsilane |
| SMILES | COCC[C@H](CCI)O[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H47IO5SSi/c1-28-16-18-31(19-17-28)41(36,37)27-23-30(40-29(20-24-35)21-25-38-5)22-26-39-42(34(2,3)4,32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-19,29-30H,20-27H2,1-5H3/t29-,30+/m0/s1 |
| InChIKey | PVYDEQXBHFIXHM-XZWHSSHBSA-N |
| XLogP | 6.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|